C18H20N2O5 — CID 26865685
1-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 26865685) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 26865685 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@H](C)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C18H20N2O5/c1-11(12-4-6-15-17(8-12)25-10-24-15)19-18(21)20-13-5-7-14(22-2)16(9-13)23-3/h4-9,11H,10H2,1-3H3,(H2,19,20,21)/t11-/m1/s1 |
| InChIKey | CCCQDVJIGGDOAK-LLVKDONJSA-N |
| XLogP | 3.32 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |