C17H15F3N2O3 — CID 27519093
1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 27519093) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 27519093 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cccc(C(F)(F)F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15F3N2O3/c1-10(11-5-6-14-15(7-11)25-9-24-14)21-16(23)22-13-4-2-3-12(8-13)17(18,19)20/h2-8,10H,9H2,1H3,(H2,21,22,23)/t10-/m0/s1 |
| InChIKey | MCZGZMFNGRPFKC-JTQLQIEISA-N |
| XLogP | 4.32 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |