C18H18F3N3O2 — CID 51944566
N-[3-[(1R)-1-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]phenyl]acetamide (PubChem CID 51944566) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is N-[3-[(1R)-1-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[(1R)-1-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 51944566 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[3-[(1R)-1-[[4-(trifluoromethyl)phenyl]carbamoylamino]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc([C@@H](C)NC(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H18F3N3O2/c1-11(13-4-3-5-16(10-13)23-12(2)25)22-17(26)24-15-8-6-14(7-9-15)18(19,20)21/h3-11H,1-2H3,(H,23,25)(H2,22,24,26)/t11-/m1/s1 |
| InChIKey | ZLAVIJBAWIHGGF-LLVKDONJSA-N |
| XLogP | 4.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |