C16H15FN2O3 — CID 24819117
1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(4-fluorophenyl)urea (PubChem CID 24819117) has the molecular formula C16H15FN2O3 and a molecular weight of 302.31 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 24819117 |
| Molecular Formula | C16H15FN2O3 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(4-fluorophenyl)urea |
| SMILES | CC(NC(=O)Nc1ccc(F)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15FN2O3/c1-10(11-2-7-14-15(8-11)22-9-21-14)18-16(20)19-13-5-3-12(17)4-6-13/h2-8,10H,9H2,1H3,(H2,18,19,20) |
| InChIKey | UVXWVOBVWCTFCX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |