C17H17FN2O2S — CID 78708992
1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(4-fluorophenyl)thiourea (PubChem CID 78708992) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 78708992 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(4-fluorophenyl)thiourea |
| SMILES | CC(NC(=S)Nc1ccc(F)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H17FN2O2S/c1-11(12-2-7-15-16(10-12)22-9-8-21-15)19-17(23)20-14-5-3-13(18)4-6-14/h2-7,10-11H,8-9H2,1H3,(H2,19,20,23) |
| InChIKey | UMQFVJLNVROAFN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|