C19H21FN2S — CID 9097432
1-(4-fluorophenyl)-3-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea (PubChem CID 9097432) has the molecular formula C19H21FN2S and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 9097432 |
| Molecular Formula | C19H21FN2S |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(F)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H21FN2S/c1-13(15-7-6-14-4-2-3-5-16(14)12-15)21-19(23)22-18-10-8-17(20)9-11-18/h6-13H,2-5H2,1H3,(H2,21,22,23)/t13-/m0/s1 |
| InChIKey | CHLZDGQUSYVHDQ-ZDUSSCGKSA-N |
| XLogP | 4.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|