C24H30N2O2 — CID 108511276
N-(4-tert-butylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide (PubChem CID 108511276) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide.
| Compound Name | N-(4-tert-butylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108511276 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-(4-tert-butylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccc(C(C)(C)C)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H30N2O2/c1-16(18-10-9-17-7-5-6-8-19(17)15-18)25-22(27)23(28)26-21-13-11-20(12-14-21)24(2,3)4/h9-16H,5-8H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | HOIQCRJHCIOCEN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|