C22H26N2O2 — CID 108511155
N-(2,3-dimethylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide (PubChem CID 108511155) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide.
| Compound Name | N-(2,3-dimethylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108511155 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NC(C)c2ccc3c(c2)CCCC3)c1C |
| InChI | InChI=1S/C22H26N2O2/c1-14-7-6-10-20(15(14)2)24-22(26)21(25)23-16(3)18-12-11-17-8-4-5-9-19(17)13-18/h6-7,10-13,16H,4-5,8-9H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | ADOQUSKBYNIFHG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|