C23H23N3O2 — CID 94908546
N-quinolin-6-yl-N'-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide (PubChem CID 94908546) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-quinolin-6-yl-N'-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide.
| Compound Name | N-quinolin-6-yl-N'-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 94908546 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-quinolin-6-yl-N'-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
| SMILES | C[C@H](NC(=O)C(=O)Nc1ccc2ncccc2c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H23N3O2/c1-15(17-9-8-16-5-2-3-6-18(16)13-17)25-22(27)23(28)26-20-10-11-21-19(14-20)7-4-12-24-21/h4,7-15H,2-3,5-6H2,1H3,(H,25,27)(H,26,28)/t15-/m0/s1 |
| InChIKey | OEOVAQHZYOGRIE-HNNXBMFYSA-N |
| XLogP | 3.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|