C20H21BrN2O2 — CID 108511313
N-(2-bromophenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide (PubChem CID 108511313) has the molecular formula C20H21BrN2O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide.
| Compound Name | N-(2-bromophenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 108511313 |
| Molecular Formula | C20H21BrN2O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-(2-bromophenyl)-N'-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccccc1Br)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H21BrN2O2/c1-13(15-11-10-14-6-2-3-7-16(14)12-15)22-19(24)20(25)23-18-9-5-4-8-17(18)21/h4-5,8-13H,2-3,6-7H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | RVCZWINRKVLUEC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|