About N-(cyanomethyl)-N'-quinolin-6-yloxamide
N-(cyanomethyl)-N'-quinolin-6-yloxamide (PubChem CID 62634263) has the molecular formula C13H10N4O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-quinolin-6-yloxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N'-quinolin-6-yloxamide |
| PubChem CID | 62634263 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-(cyanomethyl)-N'-quinolin-6-yloxamide |
| SMILES | N#CCNC(=O)C(=O)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H10N4O2/c14-5-7-16-12(18)13(19)17-10-3-4-11-9(8-10)2-1-6-15-11/h1-4,6,8H,7H2,(H,16,18)(H,17,19) |
| InChIKey | QVIQAPKFFQGYIN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N'-quinolin-6-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N'-quinolin-6-yloxamide?
The IUPAC name of N-(cyanomethyl)-N'-quinolin-6-yloxamide (CID 62634263) is N-(cyanomethyl)-N'-quinolin-6-yloxamide.
What is the SMILES notation for N-(cyanomethyl)-N'-quinolin-6-yloxamide?
The canonical SMILES for N-(cyanomethyl)-N'-quinolin-6-yloxamide is N#CCNC(=O)C(=O)Nc1ccc2ncccc2c1.
What is the InChIKey of N-(cyanomethyl)-N'-quinolin-6-yloxamide?
The InChIKey is QVIQAPKFFQGYIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2/c14-5-7-16-12(18)13(19)17-10-3-4-11-9(8-10)2-1-6-15-11/h1-4,6,8H,7H2,(H,16,18)(H,17,19).
What are the key properties of N-(cyanomethyl)-N'-quinolin-6-yloxamide?
N-(cyanomethyl)-N'-quinolin-6-yloxamide has a molecular weight of 254.25 g/mol, XLogP of 0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N'-quinolin-6-yloxamide is sourced from PubChem (CID 62634263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).