C19H21ClN2S — CID 127072457
1-(4-chlorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea (PubChem CID 127072457) has the molecular formula C19H21ClN2S and a molecular weight of 344.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 127072457 |
| Molecular Formula | C19H21ClN2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]thiourea |
| SMILES | CC(NC(=S)Nc1ccc(Cl)cc1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H21ClN2S/c1-13(15-7-6-14-4-2-3-5-16(14)12-15)21-19(23)22-18-10-8-17(20)9-11-18/h6-13H,2-5H2,1H3,(H2,21,22,23) |
| InChIKey | ATOPUNJOUWQDAF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|