C18H18N2O5 — CID 17218066
methyl 4-[1-(1,3-benzodioxol-5-yl)ethylcarbamoylamino]benzoate (PubChem CID 17218066) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl 4-[1-(1,3-benzodioxol-5-yl)ethylcarbamoylamino]benzoate.
| Compound Name | methyl 4-[1-(1,3-benzodioxol-5-yl)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 17218066 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 4-[1-(1,3-benzodioxol-5-yl)ethylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)NC(C)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H18N2O5/c1-11(13-5-8-15-16(9-13)25-10-24-15)19-18(22)20-14-6-3-12(4-7-14)17(21)23-2/h3-9,11H,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | AHKAAKYFRSRTAC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |