C18H20N2O4S — CID 40655610
1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(2,5-dimethoxyphenyl)thiourea (PubChem CID 40655610) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(2,5-dimethoxyphenyl)thiourea.
| Compound Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(2,5-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 40655610 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]-3-(2,5-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)N[C@@H](C)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-11(12-4-6-16-17(8-12)24-10-23-16)19-18(25)20-14-9-13(21-2)5-7-15(14)22-3/h4-9,11H,10H2,1-3H3,(H2,19,20,25)/t11-/m0/s1 |
| InChIKey | SIOQVLSZCZHEBJ-NSHDSACASA-N |
| XLogP | 3.48 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|