C18H21N3O5S — CID 2955578
1-(1,3-benzodioxol-5-yl)-3-[(4-butylphenyl)sulfonylamino]urea (PubChem CID 2955578) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(4-butylphenyl)sulfonylamino]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(4-butylphenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 2955578 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(4-butylphenyl)sulfonylamino]urea |
| SMILES | CCCCc1ccc(S(=O)(=O)NNC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-2-3-4-13-5-8-15(9-6-13)27(23,24)21-20-18(22)19-14-7-10-16-17(11-14)26-12-25-16/h5-11,21H,2-4,12H2,1H3,(H2,19,20,22) |
| InChIKey | NSYUQYPSDOSZRV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|