C20H25NO4S — CID 84556940
N-(1,3-benzodioxol-5-ylmethyl)-4-hexylbenzenesulfonamide (PubChem CID 84556940) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-hexylbenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-hexylbenzenesulfonamide |
|---|---|
| PubChem CID | 84556940 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-hexylbenzenesulfonamide |
| SMILES | CCCCCCc1ccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-2-3-4-5-6-16-7-10-18(11-8-16)26(22,23)21-14-17-9-12-19-20(13-17)25-15-24-19/h7-13,21H,2-6,14-15H2,1H3 |
| InChIKey | WPPXRIUTWDYYAE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|