C18H21NO5S — CID 16644771
N-(1,3-benzodioxol-5-ylmethyl)-3-methyl-4-propoxybenzenesulfonamide (PubChem CID 16644771) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-methyl-4-propoxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-methyl-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16644771 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-methyl-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1C |
| InChI | InChI=1S/C18H21NO5S/c1-3-8-22-16-7-5-15(9-13(16)2)25(20,21)19-11-14-4-6-17-18(10-14)24-12-23-17/h4-7,9-10,19H,3,8,11-12H2,1-2H3 |
| InChIKey | KBLZLJDCSMRWJS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |