C16H17NO5S — CID 741468
N-(1,3-benzodioxol-5-ylmethyl)-4-ethoxybenzenesulfonamide (PubChem CID 741468) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-ethoxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 741468 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H17NO5S/c1-2-20-13-4-6-14(7-5-13)23(18,19)17-10-12-3-8-15-16(9-12)22-11-21-15/h3-9,17H,2,10-11H2,1H3 |
| InChIKey | WHPSIVJQZWCNQN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |