C17H19NO5S — CID 30366365
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-ethylbenzenesulfonamide (PubChem CID 30366365) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-ethylbenzenesulfonamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 30366365 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-4-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCOc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-2-13-3-6-15(7-4-13)24(19,20)18-9-10-21-14-5-8-16-17(11-14)23-12-22-16/h3-8,11,18H,2,9-10,12H2,1H3 |
| InChIKey | LBTDCXRBTCJQGS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|