C19H23NO5S — CID 113100545
N-[2-(4-tert-butylphenoxy)ethyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 113100545) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenoxy)ethyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[2-(4-tert-butylphenoxy)ethyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 113100545 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[2-(4-tert-butylphenoxy)ethyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | CC(C)(C)c1ccc(OCCNS(=O)(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H23NO5S/c1-19(2,3)14-4-6-15(7-5-14)23-11-10-20-26(21,22)16-8-9-17-18(12-16)25-13-24-17/h4-9,12,20H,10-11,13H2,1-3H3 |
| InChIKey | WLWIWGMACFEDOC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|