C20H24N2O6S — CID 55846957
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide (PubChem CID 55846957) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55846957 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)NCCOc2ccc3c(c2)OCO3)cc1C |
| InChI | InChI=1S/C20H24N2O6S/c1-14-3-5-17(11-15(14)2)29(24,25)22-8-7-20(23)21-9-10-26-16-4-6-18-19(12-16)28-13-27-18/h3-6,11-12,22H,7-10,13H2,1-2H3,(H,21,23) |
| InChIKey | JBFVPBIJSUZGHR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|