C17H13F6NO5S — CID 30366380
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 30366380) has the molecular formula C17H13F6NO5S and a molecular weight of 457.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 30366380 |
| Molecular Formula | C17H13F6NO5S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc2c(c1)OCO2)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F6NO5S/c18-16(19,20)10-5-11(17(21,22)23)7-13(6-10)30(25,26)24-3-4-27-12-1-2-14-15(8-12)29-9-28-14/h1-2,5-8,24H,3-4,9H2 |
| InChIKey | COLGJPBWUPKPDH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|