C18H12F12N2O4S2 — CID 2804037
N-[2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 2804037) has the molecular formula C18H12F12N2O4S2 and a molecular weight of 612.41 g/mol. Its IUPAC name is N-[2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2804037 |
| Molecular Formula | C18H12F12N2O4S2 |
| Molecular Weight | 612.41 g/mol |
| Exact Mass | 612.00 |
| IUPAC Name | N-[2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]ethyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCNS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F12N2O4S2/c19-15(20,21)9-3-10(16(22,23)24)6-13(5-9)37(33,34)31-1-2-32-38(35,36)14-7-11(17(25,26)27)4-12(8-14)18(28,29)30/h3-8,31-32H,1-2H2 |
| InChIKey | ATZVCEOSVRNPTR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|