C12H13F6NO4S — CID 3436267
N-(2,2-dimethoxyethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 3436267) has the molecular formula C12H13F6NO4S and a molecular weight of 381.29 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3436267 |
| Molecular Formula | C12H13F6NO4S |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C12H13F6NO4S/c1-22-10(23-2)6-19-24(20,21)9-4-7(11(13,14)15)3-8(5-9)12(16,17)18/h3-5,10,19H,6H2,1-2H3 |
| InChIKey | TVZGIIQDBJKCRV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|