C10H13Cl2NO4S — CID 3498417
3,4-dichloro-N-(2,2-dimethoxyethyl)benzenesulfonamide (PubChem CID 3498417) has the molecular formula C10H13Cl2NO4S and a molecular weight of 314.19 g/mol. Its IUPAC name is 3,4-dichloro-N-(2,2-dimethoxyethyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(2,2-dimethoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3498417 |
| Molecular Formula | C10H13Cl2NO4S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 3,4-dichloro-N-(2,2-dimethoxyethyl)benzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1ccc(Cl)c(Cl)c1)OC |
| InChI | InChI=1S/C10H13Cl2NO4S/c1-16-10(17-2)6-13-18(14,15)7-3-4-8(11)9(12)5-7/h3-5,10,13H,6H2,1-2H3 |
| InChIKey | HPAPAMVWQQFHNT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|