C11H14ClNO6S — CID 78907701
2-chloro-5-(2,2-dimethoxyethylsulfamoyl)benzoic acid (PubChem CID 78907701) has the molecular formula C11H14ClNO6S and a molecular weight of 323.75 g/mol. Its IUPAC name is 2-chloro-5-(2,2-dimethoxyethylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-5-(2,2-dimethoxyethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 78907701 |
| Molecular Formula | C11H14ClNO6S |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-chloro-5-(2,2-dimethoxyethylsulfamoyl)benzoic acid |
| SMILES | COC(CNS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1)OC |
| InChI | InChI=1S/C11H14ClNO6S/c1-18-10(19-2)6-13-20(16,17)7-3-4-9(12)8(5-7)11(14)15/h3-5,10,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | HFSXDENMMYFGCB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|