C11H12ClNO4S — CID 114615359
2-chloro-5-(2-methylprop-2-enylsulfamoyl)benzoic acid (PubChem CID 114615359) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is 2-chloro-5-(2-methylprop-2-enylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-5-(2-methylprop-2-enylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 114615359 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-chloro-5-(2-methylprop-2-enylsulfamoyl)benzoic acid |
| SMILES | C=C(C)CNS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12ClNO4S/c1-7(2)6-13-18(16,17)8-3-4-10(12)9(5-8)11(14)15/h3-5,13H,1,6H2,2H3,(H,14,15) |
| InChIKey | CIKVJGWVRUPIBG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|