C10H13ClN2O6S2 — CID 43420743
2-chloro-5-[2-(methanesulfonamido)ethylsulfamoyl]benzoic acid (PubChem CID 43420743) has the molecular formula C10H13ClN2O6S2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-chloro-5-[2-(methanesulfonamido)ethylsulfamoyl]benzoic acid.
| Compound Name | 2-chloro-5-[2-(methanesulfonamido)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 43420743 |
| Molecular Formula | C10H13ClN2O6S2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 2-chloro-5-[2-(methanesulfonamido)ethylsulfamoyl]benzoic acid |
| SMILES | CS(=O)(=O)NCCNS(=O)(=O)c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H13ClN2O6S2/c1-20(16,17)12-4-5-13-21(18,19)7-2-3-9(11)8(6-7)10(14)15/h2-3,6,12-13H,4-5H2,1H3,(H,14,15) |
| InChIKey | CSUFRDFDNVPCRP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|