C10H12ClNO6S2 — CID 107089953
2-chloro-4-(2-methylsulfonylethylsulfamoyl)benzoic acid (PubChem CID 107089953) has the molecular formula C10H12ClNO6S2 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-chloro-4-(2-methylsulfonylethylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-4-(2-methylsulfonylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 107089953 |
| Molecular Formula | C10H12ClNO6S2 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-chloro-4-(2-methylsulfonylethylsulfamoyl)benzoic acid |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO6S2/c1-19(15,16)5-4-12-20(17,18)7-2-3-8(10(13)14)9(11)6-7/h2-3,6,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | TVWAQGZFRMMAFX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |