C12H17NO5S — CID 60643280
4-acetyl-N-(2,2-dimethoxyethyl)benzenesulfonamide (PubChem CID 60643280) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-acetyl-N-(2,2-dimethoxyethyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(2,2-dimethoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60643280 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-acetyl-N-(2,2-dimethoxyethyl)benzenesulfonamide |
| SMILES | COC(CNS(=O)(=O)c1ccc(C(C)=O)cc1)OC |
| InChI | InChI=1S/C12H17NO5S/c1-9(14)10-4-6-11(7-5-10)19(15,16)13-8-12(17-2)18-3/h4-7,12-13H,8H2,1-3H3 |
| InChIKey | DXFIJPSQACCKKA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|