C10H11F2NO3S — CID 79090168
4-acetyl-N-(2,2-difluoroethyl)benzenesulfonamide (PubChem CID 79090168) has the molecular formula C10H11F2NO3S and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-acetyl-N-(2,2-difluoroethyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N-(2,2-difluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79090168 |
| Molecular Formula | C10H11F2NO3S |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 4-acetyl-N-(2,2-difluoroethyl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCC(F)F)cc1 |
| InChI | InChI=1S/C10H11F2NO3S/c1-7(14)8-2-4-9(5-3-8)17(15,16)13-6-10(11)12/h2-5,10,13H,6H2,1H3 |
| InChIKey | PBUYXRFHVKFBEO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |