C11H14F2N2O4S — CID 103836774
4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]-N-methylbenzamide (PubChem CID 103836774) has the molecular formula C11H14F2N2O4S and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]-N-methylbenzamide.
| Compound Name | 4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 103836774 |
| Molecular Formula | C11H14F2N2O4S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-[(3,3-difluoro-2-hydroxypropyl)sulfamoyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)NCC(O)C(F)F)cc1 |
| InChI | InChI=1S/C11H14F2N2O4S/c1-14-11(17)7-2-4-8(5-3-7)20(18,19)15-6-9(16)10(12)13/h2-5,9-10,15-16H,6H2,1H3,(H,14,17) |
| InChIKey | OXNQCZUXHVIZMO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |