C13H13F2NO3S — CID 103836737
N-(3,3-difluoro-2-hydroxypropyl)naphthalene-2-sulfonamide (PubChem CID 103836737) has the molecular formula C13H13F2NO3S and a molecular weight of 301.31 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)naphthalene-2-sulfonamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 103836737 |
| Molecular Formula | C13H13F2NO3S |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(O)C(F)F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H13F2NO3S/c14-13(15)12(17)8-16-20(18,19)11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12-13,16-17H,8H2 |
| InChIKey | DRUZJCBDGRKZOE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |