C17H17NO3S2 — CID 90496859
N-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]naphthalene-2-sulfonamide (PubChem CID 90496859) has the molecular formula C17H17NO3S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 90496859 |
| Molecular Formula | C17H17NO3S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]naphthalene-2-sulfonamide |
| SMILES | Cc1ccsc1C(O)CNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H17NO3S2/c1-12-8-9-22-17(12)16(19)11-18-23(20,21)15-7-6-13-4-2-3-5-14(13)10-15/h2-10,16,18-19H,11H2,1H3 |
| InChIKey | RJBAAIMMHYYLAS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |