C15H21ClN2O2S — CID 120664537
N-[(2R)-2-(ethylamino)propyl]naphthalene-2-sulfonamide;hydrochloride (PubChem CID 120664537) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.87 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]naphthalene-2-sulfonamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]naphthalene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120664537 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]naphthalene-2-sulfonamide;hydrochloride |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C15H20N2O2S.ClH/c1-3-16-12(2)11-17-20(18,19)15-9-8-13-6-4-5-7-14(13)10-15;/h4-10,12,16-17H,3,11H2,1-2H3;1H/t12-;/m1./s1 |
| InChIKey | DISYQQGNHOTUFI-UTONKHPSSA-N |
| XLogP | 2.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |