C11H17BrClN3O4S — CID 120664929
3-bromo-N-[(2R)-2-(ethylamino)propyl]-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120664929) has the molecular formula C11H17BrClN3O4S and a molecular weight of 402.70 g/mol. Its IUPAC name is 3-bromo-N-[(2R)-2-(ethylamino)propyl]-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 3-bromo-N-[(2R)-2-(ethylamino)propyl]-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120664929 |
| Molecular Formula | C11H17BrClN3O4S |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 3-bromo-N-[(2R)-2-(ethylamino)propyl]-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1ccc([N+](=O)[O-])c(Br)c1.Cl |
| InChI | InChI=1S/C11H16BrN3O4S.ClH/c1-3-13-8(2)7-14-20(18,19)9-4-5-11(15(16)17)10(12)6-9;/h4-6,8,13-14H,3,7H2,1-2H3;1H/t8-;/m1./s1 |
| InChIKey | PQVCGRWFMQZGGF-DDWIOCJRSA-N |
| XLogP | 2.06 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|