C12H19N3O4S — CID 120664804
N-[(2R)-2-(ethylamino)propyl]-2-methyl-3-nitrobenzenesulfonamide (PubChem CID 120664804) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120664804 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-methyl-3-nitrobenzenesulfonamide |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H19N3O4S/c1-4-13-9(2)8-14-20(18,19)12-7-5-6-11(10(12)3)15(16)17/h5-7,9,13-14H,4,8H2,1-3H3/t9-/m1/s1 |
| InChIKey | RPZMTPPZGGTENM-SECBINFHSA-N |
| XLogP | 1.18 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|