C12H16N2O4S — CID 115628675
2-methyl-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide (PubChem CID 115628675) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide.
| Compound Name | 2-methyl-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115628675 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-methyl-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H16N2O4S/c1-3-4-5-9-13-19(17,18)12-8-6-7-11(10(12)2)14(15)16/h3-4,6-8,13H,5,9H2,1-2H3/b4-3+ |
| InChIKey | XVQZHXVOKJODOZ-ONEGZZNKSA-N |
| XLogP | 2.15 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|