C12H18N2O5S — CID 115363056
N-(3-hydroxy-2,2-dimethylpropyl)-2-methyl-3-nitrobenzenesulfonamide (PubChem CID 115363056) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)-2-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)-2-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115363056 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)-2-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cccc1S(=O)(=O)NCC(C)(C)CO |
| InChI | InChI=1S/C12H18N2O5S/c1-9-10(14(16)17)5-4-6-11(9)20(18,19)13-7-12(2,3)8-15/h4-6,13,15H,7-8H2,1-3H3 |
| InChIKey | BJYHLWYDBCXUAZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|