C11H13FN2O4S — CID 113465539
4-fluoro-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide (PubChem CID 113465539) has the molecular formula C11H13FN2O4S and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-fluoro-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113465539 |
| Molecular Formula | C11H13FN2O4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-fluoro-3-nitro-N-[(E)-pent-3-enyl]benzenesulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13FN2O4S/c1-2-3-4-7-13-19(17,18)9-5-6-10(12)11(8-9)14(15)16/h2-3,5-6,8,13H,4,7H2,1H3/b3-2+ |
| InChIKey | KJAIMIYNPWRWGX-NSCUHMNNSA-N |
| XLogP | 1.98 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|