C13H20ClN3O6S — CID 120664943
N-[(2R)-2-(ethylamino)propyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide;hydrochloride (PubChem CID 120664943) has the molecular formula C13H20ClN3O6S and a molecular weight of 381.84 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120664943 |
| Molecular Formula | C13H20ClN3O6S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide;hydrochloride |
| SMILES | CCN[C@H](C)CNS(=O)(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2.Cl |
| InChI | InChI=1S/C13H19N3O6S.ClH/c1-3-14-9(2)8-15-23(19,20)13-7-12-11(21-4-5-22-12)6-10(13)16(17)18;/h6-7,9,14-15H,3-5,8H2,1-2H3;1H/t9-;/m1./s1 |
| InChIKey | LYBFITGTDKELPZ-SBSPUUFOSA-N |
| XLogP | 1.06 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|