C15H21N3O6S — CID 120585219
N-(2-amino-1-cyclopentylethyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 120585219) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-(2-amino-1-cyclopentylethyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-(2-amino-1-cyclopentylethyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 120585219 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-(2-amino-1-cyclopentylethyl)-7-nitro-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | NCC(NS(=O)(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)C1CCCC1 |
| InChI | InChI=1S/C15H21N3O6S/c16-9-11(10-3-1-2-4-10)17-25(21,22)15-8-14-13(23-5-6-24-14)7-12(15)18(19)20/h7-8,10-11,17H,1-6,9,16H2 |
| InChIKey | IHGRKGDIGFDIQE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|