C15H24ClN3O5S — CID 119983590
N-(2-amino-1-cyclohexylethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119983590) has the molecular formula C15H24ClN3O5S and a molecular weight of 393.89 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983590 |
| Molecular Formula | C15H24ClN3O5S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1cc(S(=O)(=O)NC(CN)C2CCCCC2)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H23N3O5S.ClH/c1-23-15-9-12(7-8-14(15)18(19)20)24(21,22)17-13(10-16)11-5-3-2-4-6-11;/h7-9,11,13,17H,2-6,10,16H2,1H3;1H |
| InChIKey | FHCLSCQMELUCSU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|