C15H23FN2O3S — CID 120710803
N-(2-amino-1-cyclohexylethyl)-4-fluoro-3-methoxybenzenesulfonamide (PubChem CID 120710803) has the molecular formula C15H23FN2O3S and a molecular weight of 330.42 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-4-fluoro-3-methoxybenzenesulfonamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-4-fluoro-3-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 120710803 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-4-fluoro-3-methoxybenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NC(CN)C2CCCCC2)ccc1F |
| InChI | InChI=1S/C15H23FN2O3S/c1-21-15-9-12(7-8-13(15)16)22(19,20)18-14(10-17)11-5-3-2-4-6-11/h7-9,11,14,18H,2-6,10,17H2,1H3 |
| InChIKey | ZNIHKLJYBPJBIE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |