C9H14ClN3O5S — CID 119960042
N-(2-aminoethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119960042) has the molecular formula C9H14ClN3O5S and a molecular weight of 311.75 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119960042 |
| Molecular Formula | C9H14ClN3O5S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | N-(2-aminoethyl)-3-methoxy-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | COc1cc(S(=O)(=O)NCCN)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C9H13N3O5S.ClH/c1-17-9-6-7(2-3-8(9)12(13)14)18(15,16)11-5-4-10;/h2-3,6,11H,4-5,10H2,1H3;1H |
| InChIKey | SFHNHBPYVMSCOF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|