C13H21N3O5S — CID 119993030
N-(1-aminohexan-2-yl)-3-methoxy-4-nitrobenzenesulfonamide (PubChem CID 119993030) has the molecular formula C13H21N3O5S and a molecular weight of 331.39 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-methoxy-4-nitrobenzenesulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-3-methoxy-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119993030 |
| Molecular Formula | C13H21N3O5S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-methoxy-4-nitrobenzenesulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc([N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C13H21N3O5S/c1-3-4-5-10(9-14)15-22(19,20)11-6-7-12(16(17)18)13(8-11)21-2/h6-8,10,15H,3-5,9,14H2,1-2H3 |
| InChIKey | GYBFUJNIVLMNHI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|