C14H23N3O4S — CID 120712495
N-(1-aminohexan-2-yl)-2,4-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 120712495) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2,4-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-2,4-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 120712495 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2,4-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)c1cc([N+](=O)[O-])c(C)cc1C |
| InChI | InChI=1S/C14H23N3O4S/c1-4-5-6-12(9-15)16-22(20,21)14-8-13(17(18)19)10(2)7-11(14)3/h7-8,12,16H,4-6,9,15H2,1-3H3 |
| InChIKey | VGRKMESOIRZHOE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|