C16H25N3O6S — CID 119993010
ethyl 5-(1-aminohexan-2-ylsulfamoyl)-2-methyl-3-nitrobenzoate (PubChem CID 119993010) has the molecular formula C16H25N3O6S and a molecular weight of 387.46 g/mol. Its IUPAC name is ethyl 5-(1-aminohexan-2-ylsulfamoyl)-2-methyl-3-nitrobenzoate.
| Compound Name | ethyl 5-(1-aminohexan-2-ylsulfamoyl)-2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 119993010 |
| Molecular Formula | C16H25N3O6S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | ethyl 5-(1-aminohexan-2-ylsulfamoyl)-2-methyl-3-nitrobenzoate |
| SMILES | CCCCC(CN)NS(=O)(=O)c1cc(C(=O)OCC)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H25N3O6S/c1-4-6-7-12(10-17)18-26(23,24)13-8-14(16(20)25-5-2)11(3)15(9-13)19(21)22/h8-9,12,18H,4-7,10,17H2,1-3H3 |
| InChIKey | DHDMFWFQIZRHFX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|