C14H21ClN2O4S — CID 124616613
methyl 4-[[(2R)-1-aminohexan-2-yl]sulfamoyl]-2-chlorobenzoate (PubChem CID 124616613) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is methyl 4-[[(2R)-1-aminohexan-2-yl]sulfamoyl]-2-chlorobenzoate.
| Compound Name | methyl 4-[[(2R)-1-aminohexan-2-yl]sulfamoyl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 124616613 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 4-[[(2R)-1-aminohexan-2-yl]sulfamoyl]-2-chlorobenzoate |
| SMILES | CCCC[C@H](CN)NS(=O)(=O)c1ccc(C(=O)OC)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O4S/c1-3-4-5-10(9-16)17-22(19,20)11-6-7-12(13(15)8-11)14(18)21-2/h6-8,10,17H,3-5,9,16H2,1-2H3/t10-/m1/s1 |
| InChIKey | LWMBIXPAMLMGDV-SNVBAGLBSA-N |
| XLogP | 1.92 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |