C13H22Cl2N2O3S — CID 119993347
N-(1-aminohexan-2-yl)-3-chloro-4-methoxybenzenesulfonamide;hydrochloride (PubChem CID 119993347) has the molecular formula C13H22Cl2N2O3S and a molecular weight of 357.30 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-chloro-4-methoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-3-chloro-4-methoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119993347 |
| Molecular Formula | C13H22Cl2N2O3S |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-chloro-4-methoxybenzenesulfonamide;hydrochloride |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc(OC)c(Cl)c1.Cl |
| InChI | InChI=1S/C13H21ClN2O3S.ClH/c1-3-4-5-10(9-15)16-20(17,18)11-6-7-13(19-2)12(14)8-11;/h6-8,10,16H,3-5,9,15H2,1-2H3;1H |
| InChIKey | SIKFBQXFIDRZMA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |